C11H11N5OS2 — CID 79883182
2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-benzoxazol-6-amine (PubChem CID 79883182) has the molecular formula C11H11N5OS2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79883182 |
| Molecular Formula | C11H11N5OS2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-benzoxazol-6-amine |
| SMILES | CN(C)c1nnc(Sc2nc3ccc(N)cc3o2)s1 |
| InChI | InChI=1S/C11H11N5OS2/c1-16(2)9-14-15-11(18-9)19-10-13-7-4-3-6(12)5-8(7)17-10/h3-5H,12H2,1-2H3 |
| InChIKey | ONMSSGFKCZKSJN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|