C12H8BrN3OS — CID 61371805
2-[(5-bromo-2-pyridinyl)sulfanyl]-1,3-benzoxazol-6-amine (PubChem CID 61371805) has the molecular formula C12H8BrN3OS and a molecular weight of 322.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)sulfanyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 61371805 |
| Molecular Formula | C12H8BrN3OS |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(Sc3ccc(Br)cn3)oc2c1 |
| InChI | InChI=1S/C12H8BrN3OS/c13-7-1-4-11(15-6-7)18-12-16-9-3-2-8(14)5-10(9)17-12/h1-6H,14H2 |
| InChIKey | ASJZFBIDQIOZJY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|