C16H14N2OS — CID 79883506
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-benzoxazol-6-amine (PubChem CID 79883506) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79883506 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(Sc3ccc4c(c3)CCC4)oc2c1 |
| InChI | InChI=1S/C16H14N2OS/c17-12-5-7-14-15(9-12)19-16(18-14)20-13-6-4-10-2-1-3-11(10)8-13/h4-9H,1-3,17H2 |
| InChIKey | NMAXWZRHANQCTB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|