C13H10N4O3S — CID 66456409
methyl 6-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]pyrazine-2-carboxylate (PubChem CID 66456409) has the molecular formula C13H10N4O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is methyl 6-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66456409 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl 6-[(6-amino-1,3-benzoxazol-2-yl)sulfanyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(Sc2nc3ccc(N)cc3o2)n1 |
| InChI | InChI=1S/C13H10N4O3S/c1-19-12(18)9-5-15-6-11(16-9)21-13-17-8-3-2-7(14)4-10(8)20-13/h2-6H,14H2,1H3 |
| InChIKey | KBQYQECXBBLWRY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|