C14H11N3O3S — CID 66287145
methyl 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]pyridine-2-carboxylate (PubChem CID 66287145) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is methyl 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66287145 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(Sc2nc3cc(N)ccc3o2)ccn1 |
| InChI | InChI=1S/C14H11N3O3S/c1-19-13(18)11-7-9(4-5-16-11)21-14-17-10-6-8(15)2-3-12(10)20-14/h2-7H,15H2,1H3 |
| InChIKey | LMKYGYIWOOLZOQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|