C15H13N3O4 — CID 156640331
methyl 4-(5-amino-1,3-benzoxazol-2-yl)-5-methoxypyridine-2-carboxylate (PubChem CID 156640331) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is methyl 4-(5-amino-1,3-benzoxazol-2-yl)-5-methoxypyridine-2-carboxylate.
| Compound Name | methyl 4-(5-amino-1,3-benzoxazol-2-yl)-5-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 156640331 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 4-(5-amino-1,3-benzoxazol-2-yl)-5-methoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2nc3cc(N)ccc3o2)c(OC)cn1 |
| InChI | InChI=1S/C15H13N3O4/c1-20-13-7-17-11(15(19)21-2)6-9(13)14-18-10-5-8(16)3-4-12(10)22-14/h3-7H,16H2,1-2H3 |
| InChIKey | OJISLKBZKVUSML-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|