C21H23NO5 — CID 46089137
methyl 2-(5-tert-butyl-1,3-benzoxazol-2-yl)-3,5-dimethoxybenzoate (PubChem CID 46089137) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 2-(5-tert-butyl-1,3-benzoxazol-2-yl)-3,5-dimethoxybenzoate.
| Compound Name | methyl 2-(5-tert-butyl-1,3-benzoxazol-2-yl)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 46089137 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl 2-(5-tert-butyl-1,3-benzoxazol-2-yl)-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1-c1nc2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C21H23NO5/c1-21(2,3)12-7-8-16-15(9-12)22-19(27-16)18-14(20(23)26-6)10-13(24-4)11-17(18)25-5/h7-11H,1-6H3 |
| InChIKey | FAVRVEWYTXNRFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |