C12H11BrN4O2S — CID 82703873
N-[4-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 82703873) has the molecular formula C12H11BrN4O2S and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[4-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 82703873 |
| Molecular Formula | C12H11BrN4O2S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-[4-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(Br)cc2/C(N)=N/O)cs1 |
| InChI | InChI=1S/C12H11BrN4O2S/c1-6-15-10(5-20-6)12(18)16-9-3-2-7(13)4-8(9)11(14)17-19/h2-5,19H,1H3,(H2,14,17)(H,16,18) |
| InChIKey | BXUMQAXMTYWFHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|