C14H11BrIN3O2 — CID 82697909
N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4-iodobenzamide (PubChem CID 82697909) has the molecular formula C14H11BrIN3O2 and a molecular weight of 460.07 g/mol. Its IUPAC name is N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4-iodobenzamide.
| Compound Name | N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 82697909 |
| Molecular Formula | C14H11BrIN3O2 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 458.91 |
| IUPAC Name | N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4-iodobenzamide |
| SMILES | N/C(=N/O)c1cc(Br)ccc1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11BrIN3O2/c15-9-3-6-12(11(7-9)13(17)19-21)18-14(20)8-1-4-10(16)5-2-8/h1-7,21H,(H2,17,19)(H,18,20) |
| InChIKey | YZURORPMQMAZOV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|