C13H10BrFN4O2 — CID 82697910
N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-3-fluoropyridine-4-carboxamide (PubChem CID 82697910) has the molecular formula C13H10BrFN4O2 and a molecular weight of 353.15 g/mol. Its IUPAC name is N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 82697910 |
| Molecular Formula | C13H10BrFN4O2 |
| Molecular Weight | 353.15 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-[4-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-3-fluoropyridine-4-carboxamide |
| SMILES | N/C(=N/O)c1cc(Br)ccc1NC(=O)c1ccncc1F |
| InChI | InChI=1S/C13H10BrFN4O2/c14-7-1-2-11(9(5-7)12(16)19-21)18-13(20)8-3-4-17-6-10(8)15/h1-6,21H,(H2,16,19)(H,18,20) |
| InChIKey | UOPHGTSEPBJYBP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|