C11H9BrN4O2S — CID 107800652
N-[5-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 107800652) has the molecular formula C11H9BrN4O2S and a molecular weight of 341.19 g/mol. Its IUPAC name is N-[5-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 107800652 |
| Molecular Formula | C11H9BrN4O2S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-[5-bromo-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | N/C(=N/O)c1ccc(Br)cc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C11H9BrN4O2S/c12-6-1-2-7(10(13)16-18)8(3-6)15-11(17)9-4-19-5-14-9/h1-5,18H,(H2,13,16)(H,15,17) |
| InChIKey | HQFLUMPFYZZPJF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|