C11H9N3O3S — CID 63116149
4-amino-2-(1,3-thiazole-4-carbonylamino)benzoic acid (PubChem CID 63116149) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 4-amino-2-(1,3-thiazole-4-carbonylamino)benzoic acid.
| Compound Name | 4-amino-2-(1,3-thiazole-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63116149 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-amino-2-(1,3-thiazole-4-carbonylamino)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(NC(=O)c2cscn2)c1 |
| InChI | InChI=1S/C11H9N3O3S/c12-6-1-2-7(11(16)17)8(3-6)14-10(15)9-4-18-5-13-9/h1-5H,12H2,(H,14,15)(H,16,17) |
| InChIKey | NXJNGXGTJFAKBK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|