C12H9FN2O3S — CID 63047498
methyl 4-fluoro-2-(1,3-thiazole-4-carbonylamino)benzoate (PubChem CID 63047498) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-fluoro-2-(1,3-thiazole-4-carbonylamino)benzoate.
| Compound Name | methyl 4-fluoro-2-(1,3-thiazole-4-carbonylamino)benzoate |
|---|---|
| PubChem CID | 63047498 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | methyl 4-fluoro-2-(1,3-thiazole-4-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(F)cc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C12H9FN2O3S/c1-18-12(17)8-3-2-7(13)4-9(8)15-11(16)10-5-19-6-14-10/h2-6H,1H3,(H,15,16) |
| InChIKey | SQXXHNZRHZGHGB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |