C11H9FN4O2S — CID 82685689
N-[4-fluoro-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 82685689) has the molecular formula C11H9FN4O2S and a molecular weight of 280.28 g/mol. Its IUPAC name is N-[4-fluoro-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-fluoro-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 82685689 |
| Molecular Formula | C11H9FN4O2S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-[4-fluoro-2-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | N/C(=N/O)c1cc(F)ccc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C11H9FN4O2S/c12-6-1-2-8(7(3-6)10(13)16-18)15-11(17)9-4-19-5-14-9/h1-5,18H,(H2,13,16)(H,15,17) |
| InChIKey | OGICCJKEIPOFMU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|