C11H10N4O3 — CID 63116138
4-amino-2-(1H-pyrazole-5-carbonylamino)benzoic acid (PubChem CID 63116138) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-amino-2-(1H-pyrazole-5-carbonylamino)benzoic acid.
| Compound Name | 4-amino-2-(1H-pyrazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63116138 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-amino-2-(1H-pyrazole-5-carbonylamino)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(NC(=O)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C11H10N4O3/c12-6-1-2-7(11(17)18)9(5-6)14-10(16)8-3-4-13-15-8/h1-5H,12H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | YEQSMDXGJGOENS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|