C11H8IN3O3 — CID 63111258
5-iodo-2-(1H-pyrazole-5-carbonylamino)benzoic acid (PubChem CID 63111258) has the molecular formula C11H8IN3O3 and a molecular weight of 357.11 g/mol. Its IUPAC name is 5-iodo-2-(1H-pyrazole-5-carbonylamino)benzoic acid.
| Compound Name | 5-iodo-2-(1H-pyrazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63111258 |
| Molecular Formula | C11H8IN3O3 |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 5-iodo-2-(1H-pyrazole-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H8IN3O3/c12-6-1-2-8(7(5-6)11(17)18)14-10(16)9-3-4-13-15-9/h1-5H,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | GDDNQESVTMMJLH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|