C12H12BrN5O2 — CID 107800573
N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 107800573) has the molecular formula C12H12BrN5O2 and a molecular weight of 338.17 g/mol. Its IUPAC name is N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107800573 |
| Molecular Formula | C12H12BrN5O2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)Nc1cc(Br)ccc1/C(N)=N/O |
| InChI | InChI=1S/C12H12BrN5O2/c1-6-9(5-15-17-6)12(19)16-10-4-7(13)2-3-8(10)11(14)18-20/h2-5,20H,1H3,(H2,14,18)(H,15,17)(H,16,19) |
| InChIKey | FZBNRAWWEFFTJY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|