C12H8BrN3S2 — CID 106949975
3-bromo-8-(1,3-thiazol-2-ylsulfanyl)quinolin-5-amine (PubChem CID 106949975) has the molecular formula C12H8BrN3S2 and a molecular weight of 338.26 g/mol. Its IUPAC name is 3-bromo-8-(1,3-thiazol-2-ylsulfanyl)quinolin-5-amine.
| Compound Name | 3-bromo-8-(1,3-thiazol-2-ylsulfanyl)quinolin-5-amine |
|---|---|
| PubChem CID | 106949975 |
| Molecular Formula | C12H8BrN3S2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 3-bromo-8-(1,3-thiazol-2-ylsulfanyl)quinolin-5-amine |
| SMILES | Nc1ccc(Sc2nccs2)c2ncc(Br)cc12 |
| InChI | InChI=1S/C12H8BrN3S2/c13-7-5-8-9(14)1-2-10(11(8)16-6-7)18-12-15-3-4-17-12/h1-6H,14H2 |
| InChIKey | GIJTVCHKQNBXNC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|