C12H9BrN4OS — CID 106949983
3-bromo-8-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]quinolin-5-amine (PubChem CID 106949983) has the molecular formula C12H9BrN4OS and a molecular weight of 337.20 g/mol. Its IUPAC name is 3-bromo-8-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]quinolin-5-amine.
| Compound Name | 3-bromo-8-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]quinolin-5-amine |
|---|---|
| PubChem CID | 106949983 |
| Molecular Formula | C12H9BrN4OS |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 3-bromo-8-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]quinolin-5-amine |
| SMILES | Cc1nnc(Sc2ccc(N)c3cc(Br)cnc23)o1 |
| InChI | InChI=1S/C12H9BrN4OS/c1-6-16-17-12(18-6)19-10-3-2-9(14)8-4-7(13)5-15-11(8)10/h2-5H,14H2,1H3 |
| InChIKey | PBUQWXOOBDIINJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|