C8H6BrN3S2 — CID 103519175
5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine (PubChem CID 103519175) has the molecular formula C8H6BrN3S2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine.
| Compound Name | 5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine |
|---|---|
| PubChem CID | 103519175 |
| Molecular Formula | C8H6BrN3S2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | 5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine |
| SMILES | Nc1cncc(Br)c1Sc1nccs1 |
| InChI | InChI=1S/C8H6BrN3S2/c9-5-3-11-4-6(10)7(5)14-8-12-1-2-13-8/h1-4H,10H2 |
| InChIKey | HVVLRNKLMHIGNY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|