C11H7BrCl2N2S — CID 103519211
5-bromo-4-(3,4-dichlorophenyl)sulfanylpyridin-3-amine (PubChem CID 103519211) has the molecular formula C11H7BrCl2N2S and a molecular weight of 350.07 g/mol. Its IUPAC name is 5-bromo-4-(3,4-dichlorophenyl)sulfanylpyridin-3-amine.
| Compound Name | 5-bromo-4-(3,4-dichlorophenyl)sulfanylpyridin-3-amine |
|---|---|
| PubChem CID | 103519211 |
| Molecular Formula | C11H7BrCl2N2S |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 347.89 |
| IUPAC Name | 5-bromo-4-(3,4-dichlorophenyl)sulfanylpyridin-3-amine |
| SMILES | Nc1cncc(Br)c1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7BrCl2N2S/c12-7-4-16-5-10(15)11(7)17-6-1-2-8(13)9(14)3-6/h1-5H,15H2 |
| InChIKey | ABGXXOASEZDZOF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |