About 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one
5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one (PubChem CID 10563452) has the molecular formula C12H10N2OS2
and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one |
| PubChem CID | 10563452 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one |
| SMILES | Nc1cc2c(cc1Sc1nccs1)C(=O)CC2 |
| InChI | InChI=1S/C12H10N2OS2/c13-9-5-7-1-2-10(15)8(7)6-11(9)17-12-14-3-4-16-12/h3-6H,1-2,13H2 |
| InChIKey | UPVRCSGNNCCKNI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one?
The IUPAC name of 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one (CID 10563452) is 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one?
The canonical SMILES for 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one is Nc1cc2c(cc1Sc1nccs1)C(=O)CC2.
What is the InChIKey of 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one?
The InChIKey is UPVRCSGNNCCKNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2OS2/c13-9-5-7-1-2-10(15)8(7)6-11(9)17-12-14-3-4-16-12/h3-6H,1-2,13H2.
What are the key properties of 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one?
5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one has a molecular weight of 262.36 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(1,3-thiazol-2-ylsulfanyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 10563452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).