C11H9N3O2S2 — CID 61219502
7-amino-6-(1,3-thiazol-2-ylsulfanyl)-4H-1,4-benzoxazin-3-one (PubChem CID 61219502) has the molecular formula C11H9N3O2S2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 7-amino-6-(1,3-thiazol-2-ylsulfanyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(1,3-thiazol-2-ylsulfanyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61219502 |
| Molecular Formula | C11H9N3O2S2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 7-amino-6-(1,3-thiazol-2-ylsulfanyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1Sc1nccs1)NC(=O)CO2 |
| InChI | InChI=1S/C11H9N3O2S2/c12-6-3-8-7(14-10(15)5-16-8)4-9(6)18-11-13-1-2-17-11/h1-4H,5,12H2,(H,14,15) |
| InChIKey | OTLVUTBPGZQTTR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|