C11H12N2O4S — CID 43617921
methyl 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)sulfanyl]acetate (PubChem CID 43617921) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)sulfanyl]acetate.
| Compound Name | methyl 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 43617921 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C11H12N2O4S/c1-16-11(15)5-18-9-3-7-8(2-6(9)12)17-4-10(14)13-7/h2-3H,4-5,12H2,1H3,(H,13,14) |
| InChIKey | ADRYYDNWVNDNAG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|