C13H16N2O3S — CID 106494007
7-amino-6-(oxolan-2-ylmethylsulfanyl)-4H-1,4-benzoxazin-3-one (PubChem CID 106494007) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-amino-6-(oxolan-2-ylmethylsulfanyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(oxolan-2-ylmethylsulfanyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 106494007 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 7-amino-6-(oxolan-2-ylmethylsulfanyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1SCC1CCCO1)NC(=O)CO2 |
| InChI | InChI=1S/C13H16N2O3S/c14-9-4-11-10(15-13(16)6-18-11)5-12(9)19-7-8-2-1-3-17-8/h4-5,8H,1-3,6-7,14H2,(H,15,16) |
| InChIKey | JHOUJAQKNBJHMD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|