C15H18ClNO3 — CID 65158057
6-[1-chloro-3-(oxolan-2-yl)propyl]-4H-1,4-benzoxazin-3-one (PubChem CID 65158057) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 6-[1-chloro-3-(oxolan-2-yl)propyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-chloro-3-(oxolan-2-yl)propyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 65158057 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-[1-chloro-3-(oxolan-2-yl)propyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(Cl)CCC3CCCO3)cc2N1 |
| InChI | InChI=1S/C15H18ClNO3/c16-12(5-4-11-2-1-7-19-11)10-3-6-14-13(8-10)17-15(18)9-20-14/h3,6,8,11-12H,1-2,4-5,7,9H2,(H,17,18) |
| InChIKey | HPIHMXYTOROYHA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|