C14H17ClN2O2 — CID 65158100
5-[1-chloro-3-(oxolan-2-yl)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 65158100) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 5-[1-chloro-3-(oxolan-2-yl)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-chloro-3-(oxolan-2-yl)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 65158100 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-[1-chloro-3-(oxolan-2-yl)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)CCC3CCCO3)cc2[nH]1 |
| InChI | InChI=1S/C14H17ClN2O2/c15-11(5-4-10-2-1-7-19-10)9-3-6-12-13(8-9)17-14(18)16-12/h3,6,8,10-11H,1-2,4-5,7H2,(H2,16,17,18) |
| InChIKey | DQBQBPMNXWZWTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|