C13H14BrClN2O2 — CID 65157636
5-bromo-6-[1-chloro-2-(oxolan-2-yl)ethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 65157636) has the molecular formula C13H14BrClN2O2 and a molecular weight of 345.62 g/mol. Its IUPAC name is 5-bromo-6-[1-chloro-2-(oxolan-2-yl)ethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[1-chloro-2-(oxolan-2-yl)ethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 65157636 |
| Molecular Formula | C13H14BrClN2O2 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 5-bromo-6-[1-chloro-2-(oxolan-2-yl)ethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(C(Cl)CC3CCCO3)cc2[nH]1 |
| InChI | InChI=1S/C13H14BrClN2O2/c14-9-6-12-11(16-13(18)17-12)5-8(9)10(15)4-7-2-1-3-19-7/h5-7,10H,1-4H2,(H2,16,17,18) |
| InChIKey | BCFCTMJJYMQQFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|