C13H9Br2ClN2OS — CID 79997266
5-bromo-6-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 79997266) has the molecular formula C13H9Br2ClN2OS and a molecular weight of 436.56 g/mol. Its IUPAC name is 5-bromo-6-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 79997266 |
| Molecular Formula | C13H9Br2ClN2OS |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 433.85 |
| IUPAC Name | 5-bromo-6-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1cc(C(Cl)c2cc3[nH]c(=O)[nH]c3cc2Br)sc1Br |
| InChI | InChI=1S/C13H9Br2ClN2OS/c1-5-2-10(20-12(5)15)11(16)6-3-8-9(4-7(6)14)18-13(19)17-8/h2-4,11H,1H3,(H2,17,18,19) |
| InChIKey | GERHBLZUQMBXRF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|