C12H12BrClS2 — CID 79997347
2-bromo-5-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-3-methylthiophene (PubChem CID 79997347) has the molecular formula C12H12BrClS2 and a molecular weight of 335.72 g/mol. Its IUPAC name is 2-bromo-5-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-3-methylthiophene.
| Compound Name | 2-bromo-5-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 79997347 |
| Molecular Formula | C12H12BrClS2 |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 2-bromo-5-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)c2cc(C)c(Br)s2)c(C)s1 |
| InChI | InChI=1S/C12H12BrClS2/c1-6-4-10(16-12(6)13)11(14)9-5-7(2)15-8(9)3/h4-5,11H,1-3H3 |
| InChIKey | KKKRJZYWYINOJQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|