C15H16BrClO3S — CID 79999407
2-bromo-5-[chloro-(2,3,4-trimethoxyphenyl)methyl]-3-methylthiophene (PubChem CID 79999407) has the molecular formula C15H16BrClO3S and a molecular weight of 391.71 g/mol. Its IUPAC name is 2-bromo-5-[chloro-(2,3,4-trimethoxyphenyl)methyl]-3-methylthiophene.
| Compound Name | 2-bromo-5-[chloro-(2,3,4-trimethoxyphenyl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 79999407 |
| Molecular Formula | C15H16BrClO3S |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 2-bromo-5-[chloro-(2,3,4-trimethoxyphenyl)methyl]-3-methylthiophene |
| SMILES | COc1ccc(C(Cl)c2cc(C)c(Br)s2)c(OC)c1OC |
| InChI | InChI=1S/C15H16BrClO3S/c1-8-7-11(21-15(8)16)12(17)9-5-6-10(18-2)14(20-4)13(9)19-3/h5-7,12H,1-4H3 |
| InChIKey | SDZYPSCGVBXXLT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|