C13H12N4O2S — CID 62267305
7-amino-6-(4-methylpyrimidin-2-yl)sulfanyl-4H-1,4-benzoxazin-3-one (PubChem CID 62267305) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 7-amino-6-(4-methylpyrimidin-2-yl)sulfanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(4-methylpyrimidin-2-yl)sulfanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62267305 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-amino-6-(4-methylpyrimidin-2-yl)sulfanyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccnc(Sc2cc3c(cc2N)OCC(=O)N3)n1 |
| InChI | InChI=1S/C13H12N4O2S/c1-7-2-3-15-13(16-7)20-11-5-9-10(4-8(11)14)19-6-12(18)17-9/h2-5H,6,14H2,1H3,(H,17,18) |
| InChIKey | IZXLLYXSBZHION-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|