C12H12N2O2S2 — CID 61305432
ethyl 3-amino-4-(1,3-thiazol-2-ylsulfanyl)benzoate (PubChem CID 61305432) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl 3-amino-4-(1,3-thiazol-2-ylsulfanyl)benzoate.
| Compound Name | ethyl 3-amino-4-(1,3-thiazol-2-ylsulfanyl)benzoate |
|---|---|
| PubChem CID | 61305432 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl 3-amino-4-(1,3-thiazol-2-ylsulfanyl)benzoate |
| SMILES | CCOC(=O)c1ccc(Sc2nccs2)c(N)c1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-2-16-11(15)8-3-4-10(9(13)7-8)18-12-14-5-6-17-12/h3-7H,2,13H2,1H3 |
| InChIKey | KALVEJVOHMTDRJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|