C11H11N3OS2 — CID 83000388
3-amino-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)benzamide (PubChem CID 83000388) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-amino-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)benzamide.
| Compound Name | 3-amino-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 83000388 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 3-amino-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)benzamide |
| SMILES | CNC(=O)c1ccc(Sc2nccs2)c(N)c1 |
| InChI | InChI=1S/C11H11N3OS2/c1-13-10(15)7-2-3-9(8(12)6-7)17-11-14-4-5-16-11/h2-6H,12H2,1H3,(H,13,15) |
| InChIKey | ZRQQZKFVCXQJJR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|