C11H15BrFN3O — CID 107535799
2-bromo-3-fluoro-N'-hydroxy-4-[methyl(propan-2-yl)amino]benzenecarboximidamide (PubChem CID 107535799) has the molecular formula C11H15BrFN3O and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(propan-2-yl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(propan-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107535799 |
| Molecular Formula | C11H15BrFN3O |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-bromo-3-fluoro-N'-hydroxy-4-[methyl(propan-2-yl)amino]benzenecarboximidamide |
| SMILES | CC(C)N(C)c1ccc(/C(N)=N/O)c(Br)c1F |
| InChI | InChI=1S/C11H15BrFN3O/c1-6(2)16(3)8-5-4-7(11(14)15-17)9(12)10(8)13/h4-6,17H,1-3H3,(H2,14,15) |
| InChIKey | NJTQFFNDFYQEEW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|