C10H8N4O5S — CID 60702191
5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid (PubChem CID 60702191) has the molecular formula C10H8N4O5S and a molecular weight of 296.26 g/mol. Its IUPAC name is 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid.
| Compound Name | 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 60702191 |
| Molecular Formula | C10H8N4O5S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
| SMILES | Cn1c(Sc2ccc([N+](=O)[O-])c(C(=O)O)c2)n[nH]c1=O |
| InChI | InChI=1S/C10H8N4O5S/c1-13-9(17)11-12-10(13)20-5-2-3-7(14(18)19)6(4-5)8(15)16/h2-4H,1H3,(H,11,17)(H,15,16) |
| InChIKey | LVSFEXPKCQYXJX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|