C12H11N5O3S — CID 115501647
2-nitro-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile (PubChem CID 115501647) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-nitro-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile.
| Compound Name | 2-nitro-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 115501647 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-nitro-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile |
| SMILES | CC(C)n1c(Sc2ccc([N+](=O)[O-])c(C#N)c2)n[nH]c1=O |
| InChI | InChI=1S/C12H11N5O3S/c1-7(2)16-11(18)14-15-12(16)21-9-3-4-10(17(19)20)8(5-9)6-13/h3-5,7H,1-2H3,(H,14,18) |
| InChIKey | QTZIOOUKIYHMHR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|