C12H13N5OS — CID 115500082
2-amino-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile (PubChem CID 115500082) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-amino-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile.
| Compound Name | 2-amino-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 115500082 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-amino-5-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzonitrile |
| SMILES | CC(C)n1c(Sc2ccc(N)c(C#N)c2)n[nH]c1=O |
| InChI | InChI=1S/C12H13N5OS/c1-7(2)17-11(18)15-16-12(17)19-9-3-4-10(14)8(5-9)6-13/h3-5,7H,14H2,1-2H3,(H,15,18) |
| InChIKey | AXUOQUGWCPHHQC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|