C17H12ClN3O6S — CID 55340789
(4-methoxy-2-nitrophenyl) 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 55340789) has the molecular formula C17H12ClN3O6S and a molecular weight of 421.82 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (4-methoxy-2-nitrophenyl) 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55340789 |
| Molecular Formula | C17H12ClN3O6S |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | COc1ccc(OC(=O)CSc2nnc(-c3ccc(Cl)cc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12ClN3O6S/c1-25-12-6-7-14(13(8-12)21(23)24)26-15(22)9-28-17-20-19-16(27-17)10-2-4-11(18)5-3-10/h2-8H,9H2,1H3 |
| InChIKey | NAMUMFQTTFWTCH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|