C17H12N4O3S — CID 9335833
2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-5-nitrobenzonitrile (PubChem CID 9335833) has the molecular formula C17H12N4O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-5-nitrobenzonitrile.
| Compound Name | 2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 9335833 |
| Molecular Formula | C17H12N4O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-5-nitrobenzonitrile |
| SMILES | Cc1ccc(-c2nnc(Sc3ccc([N+](=O)[O-])cc3C#N)o2)cc1C |
| InChI | InChI=1S/C17H12N4O3S/c1-10-3-4-12(7-11(10)2)16-19-20-17(24-16)25-15-6-5-14(21(22)23)8-13(15)9-18/h3-8H,1-2H3 |
| InChIKey | ADGWGKOXLLVQOL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 105.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|