C21H35N5O4S — CID 60502646
1-cyclohexyl-N,N-dimethyl-N'-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]ethane-1,2-diamine (PubChem CID 60502646) has the molecular formula C21H35N5O4S and a molecular weight of 453.61 g/mol. Its IUPAC name is 1-cyclohexyl-N,N-dimethyl-N'-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]ethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N,N-dimethyl-N'-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60502646 |
| Molecular Formula | C21H35N5O4S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-cyclohexyl-N,N-dimethyl-N'-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]ethane-1,2-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NCC(C3CCCCC3)N(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H35N5O4S/c1-23(2)21(17-7-5-4-6-8-17)16-22-19-10-9-18(15-20(19)26(27)28)31(29,30)25-13-11-24(3)12-14-25/h9-10,15,17,21-22H,4-8,11-14,16H2,1-3H3 |
| InChIKey | FXGKQMLSCPDEKZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|