C17H24N6O4S — CID 133405628
N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 133405628) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 133405628 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | Cc1c(CNc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2[N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C17H24N6O4S/c1-13-14(12-19-21(13)3)11-18-16-5-4-15(10-17(16)23(24)25)28(26,27)22-8-6-20(2)7-9-22/h4-5,10,12,18H,6-9,11H2,1-3H3 |
| InChIKey | CGUNZJWTKKFMGU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|