C14H18N4O3 — CID 79569430
N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-ethoxy-2-nitroaniline (PubChem CID 79569430) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-ethoxy-2-nitroaniline.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-ethoxy-2-nitroaniline |
|---|---|
| PubChem CID | 79569430 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-ethoxy-2-nitroaniline |
| SMILES | CCOc1ccc(NCc2cnn(C)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O3/c1-4-21-12-5-6-13(14(7-12)18(19)20)15-8-11-9-16-17(3)10(11)2/h5-7,9,15H,4,8H2,1-3H3 |
| InChIKey | GLGHIXCOVMDTGB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|