C17H23N7O4S — CID 43063280
N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]-N'-pyrazin-2-ylethane-1,2-diamine (PubChem CID 43063280) has the molecular formula C17H23N7O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]-N'-pyrazin-2-ylethane-1,2-diamine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]-N'-pyrazin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 43063280 |
| Molecular Formula | C17H23N7O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]-N'-pyrazin-2-ylethane-1,2-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NCCNc3cnccn3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H23N7O4S/c1-22-8-10-23(11-9-22)29(27,28)14-2-3-15(16(12-14)24(25)26)19-6-7-21-17-13-18-4-5-20-17/h2-5,12-13,19H,6-11H2,1H3,(H,20,21) |
| InChIKey | VUSDJTBVGXXUMG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|