C18H24N6O4S — CID 31258321
2-N,2-N-dimethyl-5-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyridine-2,5-diamine (PubChem CID 31258321) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-5-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyridine-2,5-diamine.
| Compound Name | 2-N,2-N-dimethyl-5-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 31258321 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-N,2-N-dimethyl-5-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyridine-2,5-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Nc3ccc(N(C)C)nc3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H24N6O4S/c1-21(2)18-7-4-14(13-19-18)20-16-6-5-15(12-17(16)24(25)26)29(27,28)23-10-8-22(3)9-11-23/h4-7,12-13,20H,8-11H2,1-3H3 |
| InChIKey | JMJRYMMYJCMGHK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|