C14H21N3O5S — CID 42909440
N-methoxy-N-methyl-4-(3-methylpiperidin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 42909440) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-methoxy-N-methyl-4-(3-methylpiperidin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-methoxy-N-methyl-4-(3-methylpiperidin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 42909440 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-methoxy-N-methyl-4-(3-methylpiperidin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CON(C)c1ccc(S(=O)(=O)N2CCCC(C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O5S/c1-11-5-4-8-16(10-11)23(20,21)12-6-7-13(15(2)22-3)14(9-12)17(18)19/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | LTOPTUQMEFKNKV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|