C18H18F2N2O5S — CID 9195993
(3S)-1-[4-(3,4-difluorophenoxy)-3-nitrophenyl]sulfonyl-3-methylpiperidine (PubChem CID 9195993) has the molecular formula C18H18F2N2O5S and a molecular weight of 412.41 g/mol. Its IUPAC name is (3S)-1-[4-(3,4-difluorophenoxy)-3-nitrophenyl]sulfonyl-3-methylpiperidine.
| Compound Name | (3S)-1-[4-(3,4-difluorophenoxy)-3-nitrophenyl]sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 9195993 |
| Molecular Formula | C18H18F2N2O5S |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (3S)-1-[4-(3,4-difluorophenoxy)-3-nitrophenyl]sulfonyl-3-methylpiperidine |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2ccc(Oc3ccc(F)c(F)c3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H18F2N2O5S/c1-12-3-2-8-21(11-12)28(25,26)14-5-7-18(17(10-14)22(23)24)27-13-4-6-15(19)16(20)9-13/h4-7,9-10,12H,2-3,8,11H2,1H3/t12-/m0/s1 |
| InChIKey | AILAUDRAMLZGJF-LBPRGKRZSA-N |
| XLogP | 4.09 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|