C20H21N3O5S — CID 9108698
2-[4-[4-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenoxy]phenyl]acetonitrile (PubChem CID 9108698) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[4-[4-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[4-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 9108698 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[4-[4-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenoxy]phenyl]acetonitrile |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)c2ccc(Oc3ccc(CC#N)cc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H21N3O5S/c1-15-3-2-12-22(14-15)29(26,27)18-8-9-20(19(13-18)23(24)25)28-17-6-4-16(5-7-17)10-11-21/h4-9,13,15H,2-3,10,12,14H2,1H3/t15-/m1/s1 |
| InChIKey | ORXMQEAZMWDBRF-OAHLLOKOSA-N |
| XLogP | 3.87 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|