C20H29N3O6S — CID 100855954
(3R)-1-[4-[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-nitrophenyl]sulfonyl-3-methylpiperidine (PubChem CID 100855954) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is (3R)-1-[4-[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-nitrophenyl]sulfonyl-3-methylpiperidine.
| Compound Name | (3R)-1-[4-[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-nitrophenyl]sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 100855954 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (3R)-1-[4-[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-nitrophenyl]sulfonyl-3-methylpiperidine |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)c2ccc(N3CCC[C@@H](C4OCCO4)C3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H29N3O6S/c1-15-4-2-9-22(13-15)30(26,27)17-6-7-18(19(12-17)23(24)25)21-8-3-5-16(14-21)20-28-10-11-29-20/h6-7,12,15-16,20H,2-5,8-11,13-14H2,1H3/t15-,16-/m1/s1 |
| InChIKey | UECKCFOCOPIALP-HZPDHXFCSA-N |
| XLogP | 2.60 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|