C12H12N6O3S — CID 60567794
4-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-3-nitrobenzamide (PubChem CID 60567794) has the molecular formula C12H12N6O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-3-nitrobenzamide.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 60567794 |
| Molecular Formula | C12H12N6O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(Sc2nnnn2C2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N6O3S/c1-13-11(19)7-2-5-10(9(6-7)18(20)21)22-12-14-15-16-17(12)8-3-4-8/h2,5-6,8H,3-4H2,1H3,(H,13,19) |
| InChIKey | OGRFSUBOLIORRX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|